Payload Information
General Information of This Payload
| Payload ID | PAY0OHCVE |
|||||
|---|---|---|---|---|---|---|
| Name | SNS-032 |
|||||
| Synonyms |
SNS-032
Click to Show/Hide
|
|||||
| Target | Protein CDX (CDX) | |||||
| Formula | C17H24N4O2S2 |
|||||
| Isosmiles | CC(C1=CN=C(O1)CSC2=CN=C(S2)NC(C3CCNCC3)=O)(C)C |
|||||
| PubChem CID | ||||||
| InChI |
InChI=1S/C17H24N4O2S2/c1-17(2,3)12-8-19-13(23-12)10-24-14-9-20-16(25-14)21-15(22)11-4-6-18-7-5-11/h8-9,11,18H,4-7,10H2,1-3H3,(H,20,21,22)
|
|||||
| InChIKey |
OUSFTKFNBAZUKL-UHFFFAOYSA-N
|
|||||
| Pharmaceutical Properties | Molecule Weight |
380.539 |
Polar area |
80.05 |
||
Complexity |
679.691901 |
xlogp Value |
3.659 |
|||
Heavy Count |
25 |
Rot Bonds |
5 |
|||
Hbond acc |
7 |
Hbond Donor |
2 |
|||
The activity data of This Payload
| Standard Type | Value | Units | Cell line | Disease Model | Cell line ID | Reference |
|---|---|---|---|---|---|---|
| Cell-based Growth Rate | -10 | % |
U2OS cells
|
Osteosarcoma
|
||
| Cell-based Growth Rate | -10 | % |
Fibroblast cells
|
Multiple myeloma, Plasma cell myeloma
|
Undisclosed | |
| Cell-based Growth Rate | -100 | % |
U2OS cells
|
Osteosarcoma
|
||
| Cell-based Growth Rate | -100 | % |
Fibroblast cells
|
Multiple myeloma, Plasma cell myeloma
|
Undisclosed | |
| Cell-based Growth Rate | -20 | % |
HEK-293T cells
|
Normal
|
||
| Cell-based Growth Rate | -21 | % |
HEK-293T cells
|
Normal
|
||
| Cell-based Growth Rate | -23 | % |
Fibroblast cells
|
Multiple myeloma, Plasma cell myeloma
|
Undisclosed | |
| Cell-based Growth Rate | -26 | % |
Fibroblast cells
|
Multiple myeloma, Plasma cell myeloma
|
Undisclosed | |
| Cell-based Growth Rate | -28 | % |
Fibroblast cells
|
Multiple myeloma, Plasma cell myeloma
|
Undisclosed | |
| Cell-based Growth Rate | -29 | % |
HEK-293T cells
|
Normal
|
||
| Cell-based Growth Rate | -37 | % |
HEK-293T cells
|
Normal
|
||
| Cell-based Growth Rate | -41 | % |
HEK-293T cells
|
Normal
|
||
| Cell-based Growth Rate | -48 | % |
HEK-293T cells
|
Normal
|
||
| Cell-based Growth Rate | -64 | % |
HEK-293T cells
|
Normal
|
||
| Cell-based Growth Rate | -76 | % |
HEK-293T cells
|
Normal
|
||
| Cell-based Growth Rate | -80 | % |
Fibroblast cells
|
Multiple myeloma, Plasma cell myeloma
|
Undisclosed | |
| Cell-based Growth Rate | 0 | % |
U2OS cells
|
Osteosarcoma
|
||
| Cell-based Growth Rate | 0 | % |
U2OS cells
|
Osteosarcoma
|
||
| Cell-based Growth Rate | 0 | % |
U2OS cells
|
Osteosarcoma
|
||
| Cell-based Growth Rate | 0 | % |
U2OS cells
|
Osteosarcoma
|
||
| Cell-based Growth Rate | 0 | % |
U2OS cells
|
Osteosarcoma
|
||
| Cell-based Growth Rate | 0 | % |
U2OS cells
|
Osteosarcoma
|
||
| Cell-based Growth Rate | 0 | % |
U2OS cells
|
Osteosarcoma
|
||
| Cell-based Growth Rate | 0 | % |
U2OS cells
|
Osteosarcoma
|
||
| Cell-based Growth Rate | 0 | % |
Fibroblast cells
|
Multiple myeloma, Plasma cell myeloma
|
Undisclosed | |
| Cell-based Growth Rate | 0 | % |
Fibroblast cells
|
Multiple myeloma, Plasma cell myeloma
|
Undisclosed | |
| Cell-based Growth Rate | 0 | % |
Fibroblast cells
|
Multiple myeloma, Plasma cell myeloma
|
Undisclosed | |
| Cell-based Growth Rate | 0 | % |
Fibroblast cells
|
Multiple myeloma, Plasma cell myeloma
|
Undisclosed | |
| Cell-based Growth Rate | 0 | % |
Fibroblast cells
|
Multiple myeloma, Plasma cell myeloma
|
Undisclosed | |
| Cell-based Growth Rate | 0 | % |
Fibroblast cells
|
Multiple myeloma, Plasma cell myeloma
|
Undisclosed | |
| Cell-based Growth Rate | 0 | % |
Fibroblast cells
|
Multiple myeloma, Plasma cell myeloma
|
Undisclosed | |
| Cell-based Growth Rate | 0 | % |
Fibroblast cells
|
Multiple myeloma, Plasma cell myeloma
|
Undisclosed | |
| Cell-based Growth Rate | 0 | % |
Fibroblast cells
|
Multiple myeloma, Plasma cell myeloma
|
Undisclosed | |
| Cell-based Growth Rate | 0 | % |
Fibroblast cells
|
Multiple myeloma, Plasma cell myeloma
|
Undisclosed | |
| Cell-based Growth Rate | 0 | % |
HEK-293T cells
|
Normal
|
||
| Cell-based Growth Rate | 0 | % |
HEK-293T cells
|
Normal
|
||
| Cell-based Growth Rate | 0 | % |
HEK-293T cells
|
Normal
|
||
| Cell-based Growth Rate | 0 | % |
HEK-293T cells
|
Normal
|
||
| Cell-based Growth Rate | 0 | % |
HEK-293T cells
|
Normal
|
||
| Cell-based Growth Rate | 0 | % |
HEK-293T cells
|
Normal
|
||
| Cell-based Growth Rate | 0 | % |
HEK-293T cells
|
Normal
|
||
| Cell-based Growth Rate | 0 | % |
HEK-293T cells
|
Normal
|
||
| Cellular activity | 0.05 | nM min-1 (mg of protein)-1 | Undisclosed | Undisclosed | Undisclosed | |
| Cellular activity | 0.36 | % | Undisclosed | Undisclosed | Undisclosed | |
| Cell-based Percent Inhibition (%) | 1.6 | % |
Sf9 cells
|
Normal
|
||
| Cell-based Growth Rate | 100 | % |
U2OS cells
|
Osteosarcoma
|
||
| Cell-based Growth Rate | 11 | % |
Fibroblast cells
|
Multiple myeloma, Plasma cell myeloma
|
Undisclosed | |
| Cellular activity | 16 | % |
RPMI-8226 cells
|
Plasma cell myeloma
|
||
| Cellular activity | 17 | % |
RPMI-8226 cells
|
Plasma cell myeloma
|
||
| Cellular activity | 18 | % |
RPMI-8226 cells
|
Plasma cell myeloma
|
||
| Cellular activity | 19 | % |
RPMI-8226 cells
|
Plasma cell myeloma
|
||
| Cellular activity | 19 | % |
RPMI-8226 cells
|
Plasma cell myeloma
|
||
| Cell-based Growth Rate | 23 | % |
Fibroblast cells
|
Multiple myeloma, Plasma cell myeloma
|
Undisclosed | |
| Cell-based Growth Rate | 27 | % |
U2OS cells
|
Osteosarcoma
|
||
| Cellular activity | 28 | % |
RPMI-8226 cells
|
Plasma cell myeloma
|
||
| Cell-based Growth Rate | 29 | % |
U2OS cells
|
Osteosarcoma
|
||
| Cell-based Growth Rate | 32 | % |
Fibroblast cells
|
Multiple myeloma, Plasma cell myeloma
|
Undisclosed | |
| Cellular activity | 34.6 | % |
Jurkat cells
|
Childhood T acute lymphoblastic leukemia, Precursor T-cell acute lymphoblastic leukemia
|
||
| Cellular activity | 36 | % |
RPMI-8226 cells
|
Plasma cell myeloma
|
||
| Cell-based Growth Rate | 4 | % |
U2OS cells
|
Osteosarcoma
|
||
| Cellular activity | 41 | % |
HCT116 cells
|
Colon carcinoma
|
||
| Cellular activity | 44 | % |
HCT116 cells
|
Colon carcinoma
|
||
| Cell-based Growth Rate | 45 | % |
U2OS cells
|
Osteosarcoma
|
||
| Cell-based Growth Rate | 49 | % |
Fibroblast cells
|
Multiple myeloma, Plasma cell myeloma
|
Undisclosed | |
| Cell-based Growth Rate | 5 | % |
U2OS cells
|
Osteosarcoma
|
||
| Cell-based Growth Rate | 5 | % |
U2OS cells
|
Osteosarcoma
|
||
| Cellular activity | 50 | % |
RPMI-8226 cells
|
Plasma cell myeloma
|
||
| Cellular activity | 50 | % |
RPMI-8226 cells
|
Plasma cell myeloma
|
||
| Cell-based Growth Rate | 54 | % |
U2OS cells
|
Osteosarcoma
|
||
| Cellular activity | 57 | % |
RPMI-8226 cells
|
Plasma cell myeloma
|
||
| Cell-based Growth Rate | 69 | % |
U2OS cells
|
Osteosarcoma
|
||
| Cellular activity | 8 | % |
RPMI-8226 cells
|
Plasma cell myeloma
|
||
| Cellular activity | 82 | % |
RPMI-8226 cells
|
Plasma cell myeloma
|
||
| Cellular activity | 9 | % |
HCT116 cells
|
Colon carcinoma
|
||
| Half Maximal Inhibitory Concentration (IC50) | 1 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 1000 | nM |
MCF-7 cells
|
Invasive breast carcinoma of no special type
|
||
| Half Maximal Inhibitory Concentration (IC50) | >1000 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | >1000 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Cell-based Potency | 104.9 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 108.2 | nM |
Cancer cells
|
Multiple myeloma, Plasma cell myeloma
|
Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 111 | nM |
RPMI-8226 cells
|
Plasma cell myeloma
|
||
| Half Maximal Inhibitory Concentration (IC50) | 120 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 121.2 | nM |
Cancer cells
|
Multiple myeloma, Plasma cell myeloma
|
Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 134.1 | nM |
RPMI-8226 cells
|
Plasma cell myeloma
|
||
| Half Maximal Inhibitory Concentration (IC50) | 148 | nM |
RPMI-8226 cells
|
Plasma cell myeloma
|
||
| Cell-based Potency | 148.2 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 150 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 150 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 159.5 | nM |
Cancer cells
|
Multiple myeloma, Plasma cell myeloma
|
Undisclosed | |
| Cell-based Potency | 166.3 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 173 | nM |
MOLT-4 cells
|
Adult T acute lymphoblastic leukemia
|
||
| Half Maximal Inhibitory Concentration (IC50) | 184 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 187.2 | nM |
U-266 cells
|
Plasma cell myeloma
|
||
| Half Maximal Inhibitory Concentration (IC50) | 192 | nM |
RPMI-8226 cells
|
Plasma cell myeloma
|
||
| Half Maximal Inhibitory Concentration (IC50) | >19952.62 | nM |
Vero C1008 cells
|
Normal
|
||
| Cell-based Potency | 20.9 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | >20000 | nM |
Vero C1008 cells
|
Normal
|
||
| Half Maximal Inhibitory Concentration (IC50) | 21 | nM |
Sf9 cells
|
Normal
|
||
| Half Maximal Inhibitory Concentration (IC50) | 230 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 231 | nM |
RPMI-8226 cells
|
Plasma cell myeloma
|
||
| Half Maximal Inhibitory Concentration (IC50) | >25000 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | >25000 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | >25000 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 309 | nM |
MDA-MB-468 cells
|
Breast adenocarcinoma
|
[1] | |
| Half Maximal Inhibitory Concentration (IC50) | 309 | nM |
MDA-MB-468 cells
|
Breast adenocarcinoma
|
[1] | |
| Cell-based Potency | 33.2 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 340 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 340 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 340 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 340 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 3404 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 355 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 38 | nM |
Sf21 cells
|
Normal
|
||
| Half Maximal Inhibitory Concentration (IC50) | 38 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 38 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 38 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 38 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 38 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 38 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 384 | nM |
Cancer cells
|
Multiple myeloma, Plasma cell myeloma
|
Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 4 | nM |
Cancer cells
|
Multiple myeloma, Plasma cell myeloma
|
Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 4 | nM |
Cancer cells
|
Multiple myeloma, Plasma cell myeloma
|
Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 4 | nM |
Sf9 cells
|
Normal
|
||
| Half Maximal Inhibitory Concentration (IC50) | 4 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 4 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 4 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 4 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 4 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 4 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 40 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | >40000 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | >40000 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | >40000 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | >40000 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | >40000 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | >40000 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | >40000 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | >40000 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | >40000 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Cell-based Potency | 4176.3 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Cell-based Potency | 43432 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 458 | nM |
HCT116 cells
|
Colon carcinoma
|
||
| Half Maximal Inhibitory Concentration (IC50) | 46 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Cell-based Potency | 47.3 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 48 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 48 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 48 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 48 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 48 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 48 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 48 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 480 | nM |
Sf21 cells
|
Normal
|
||
| Half Maximal Inhibitory Concentration (IC50) | 480 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 480 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 480 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 480 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 480 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 480 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 480 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 480 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 48000 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 52 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 52 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Cell-based Potency | 52.6 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Cell-based Potency | 52.6 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 52.95 | nM |
Jurkat cells
|
Childhood T acute lymphoblastic leukemia, Precursor T-cell acute lymphoblastic leukemia
|
||
| Half Maximal Inhibitory Concentration (IC50) | 550 | nM |
HCT116 cells
|
Colon carcinoma
|
||
| Half Maximal Inhibitory Concentration (IC50) | 6 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 6 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 62 | nM |
Sf21 cells
|
Normal
|
||
| Half Maximal Inhibitory Concentration (IC50) | 62 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 62 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 62 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 62 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 62 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 62 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 62 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 62 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 660 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 67.1 | nM |
Cancer cells
|
Multiple myeloma, Plasma cell myeloma
|
Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 68 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 69 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Cell-based Potency | 7.4 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 7.821 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 700 | nM |
HCT116 cells
|
Colon carcinoma
|
||
| Half Maximal Inhibitory Concentration (IC50) | 79 | nM |
RPMI-8226 cells
|
Plasma cell myeloma
|
||
| Half Maximal Inhibitory Concentration (IC50) | 925 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 925 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 925 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 925 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 925 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Cell-based Potency | 93.5 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 930 | nM | Undisclosed | Undisclosed | Undisclosed | |
| Half Maximal Inhibitory Concentration (IC50) | 95 | nM |
A2780 cells
|
Ovarian endometrioid adenocarcinoma
|
||
| Half Maximal Inhibitory Concentration (IC50) | 95 | nM |
A2780 cells
|
Ovarian endometrioid adenocarcinoma
|
||
| Half Maximal Degradation Concentration (DC50) | >1 | uM |
MOLT-4 cells
|
Adult T acute lymphoblastic leukemia
|
Each Antibody-drug Conjugate Related to This Payload
Full Information of The Activity Data of The ADC(s) Related to This Payload
Cetuximab-SNS-032 ADC [Investigative]
Revealed Based on the Cell Line Data
| Experiment 1 Reporting the Activity Date of This ADC | [1] | ||||
| Efficacy Data | Half Maximal inhibitory Concentration (lC50) |
0.79 nM
|
Low HER2 expression (HER2+) | ||
| Method Description |
To measure cell viability, 5,000 cells per well were plated in 96-well plates and incubated with cetuximab, isotype ADC, ADC, or free inhibitor for 96 hours at 37°C. Cell viabilities were detected by CellTiter 96 AQueous One Solution Cell Proliferation Assay (Promega) according to the manufacturer's instructions. Optical absorbance was read on a FLUOstar Omega spectrophotometer (BMG Labtech; RRID:SCR_025024).
Click to Show/Hide
|
||||
| In Vitro Model | Breast adenocarcinoma | MDA-MB-468 cells | CVCL_0419 | ||
References